C20H19FN4S — CID 139309551
6-(7-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 139309551) has the molecular formula C20H19FN4S and a molecular weight of 366.47 g/mol. Its IUPAC name is 6-(7-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-(7-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 139309551 |
| Molecular Formula | C20H19FN4S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 6-(7-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2ccc(N3CCc4c(c5ccc(F)cc5n4C)C3)cc2s1 |
| InChI | InChI=1S/C20H19FN4S/c1-22-20-23-16-6-4-13(10-19(16)26-20)25-8-7-17-15(11-25)14-5-3-12(21)9-18(14)24(17)2/h3-6,9-10H,7-8,11H2,1-2H3,(H,22,23) |
| InChIKey | DUHFOQGYNFKCIS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|