C92H71N7 — CID 139311964
3,6-ditert-butyl-1,8-bis[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole (PubChem CID 139311964) has the molecular formula C92H71N7 and a molecular weight of 1274.63 g/mol. Its IUPAC name is 3,6-ditert-butyl-1,8-bis[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole.
| Compound Name | 3,6-ditert-butyl-1,8-bis[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 139311964 |
| Molecular Formula | C92H71N7 |
| Molecular Weight | 1274.63 g/mol |
| Exact Mass | 1273.58 |
| IUPAC Name | 3,6-ditert-butyl-1,8-bis[3-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c2)c2c(c1)c1cc(C(C)(C)C)cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)n4)c3)c1n2-c1ccccc1 |
| InChI | InChI=1S/C92H71N7/c1-91(2,3)76-56-79(66-42-28-44-68(48-66)87-93-85(64-38-22-11-23-39-64)95-89(97-87)74-52-70(60-30-14-7-15-31-60)50-71(53-74)61-32-16-8-17-33-61)83-81(58-76)82-59-77(92(4,5)6)57-80(84(82)99(83)78-46-26-13-27-47-78)67-43-29-45-69(49-67)88-94-86(65-40-24-12-25-41-65)96-90(98-88)75-54-72(62-34-18-9-19-35-62)51-73(55-75)63-36-20-10-21-37-63/h7-59H,1-6H3 |
| InChIKey | NCZWDKSOVZWZJR-UHFFFAOYSA-N |
| XLogP | 23.75 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1274.63 |
| LogP ≤ 5 | 23.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |