C56H38N6S — CID 139312034
2-[3-[6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,8-dimethyldibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 139312034) has the molecular formula C56H38N6S and a molecular weight of 827.03 g/mol. Its IUPAC name is 2-[3-[6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,8-dimethyldibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,8-dimethyldibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139312034 |
| Molecular Formula | C56H38N6S |
| Molecular Weight | 827.03 g/mol |
| Exact Mass | 826.29 |
| IUPAC Name | 2-[3-[6-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,8-dimethyldibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c2sc3c(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cc(C)cc3c2c1 |
| InChI | InChI=1S/C56H38N6S/c1-35-29-45(41-25-15-27-43(33-41)55-59-51(37-17-7-3-8-18-37)57-52(60-55)38-19-9-4-10-20-38)49-47(31-35)48-32-36(2)30-46(50(48)63-49)42-26-16-28-44(34-42)56-61-53(39-21-11-5-12-22-39)58-54(62-56)40-23-13-6-14-24-40/h3-34H,1-2H3 |
| InChIKey | XOTLJXAVMDDKAS-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.03 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |