C57H37N3S — CID 164838407
2,4-bis(4-phenylphenyl)-6-(2,6,8-triphenyldibenzothiophen-4-yl)-1,3,5-triazine (PubChem CID 164838407) has the molecular formula C57H37N3S and a molecular weight of 796.01 g/mol. Its IUPAC name is 2,4-bis(4-phenylphenyl)-6-(2,6,8-triphenyldibenzothiophen-4-yl)-1,3,5-triazine.
| Compound Name | 2,4-bis(4-phenylphenyl)-6-(2,6,8-triphenyldibenzothiophen-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 164838407 |
| Molecular Formula | C57H37N3S |
| Molecular Weight | 796.01 g/mol |
| Exact Mass | 795.27 |
| IUPAC Name | 2,4-bis(4-phenylphenyl)-6-(2,6,8-triphenyldibenzothiophen-4-yl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5ccccc5)cc5c4sc4c(-c6ccccc6)cc(-c6ccccc6)cc45)n3)cc2)cc1 |
| InChI | InChI=1S/C57H37N3S/c1-6-16-38(17-7-1)42-26-30-45(31-27-42)55-58-56(46-32-28-43(29-33-46)39-18-8-2-9-19-39)60-57(59-55)52-37-48(41-22-12-4-13-23-41)36-51-50-35-47(40-20-10-3-11-21-40)34-49(53(50)61-54(51)52)44-24-14-5-15-25-44/h1-37H |
| InChIKey | STQRSMNYPPMCRV-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.01 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |