C13H21NO2S — CID 139318427
3-hexan-3-yl-N-methylbenzenesulfonamide (PubChem CID 139318427) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 3-hexan-3-yl-N-methylbenzenesulfonamide.
| Compound Name | 3-hexan-3-yl-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 139318427 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-hexan-3-yl-N-methylbenzenesulfonamide |
| SMILES | CCCC(CC)c1cccc(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C13H21NO2S/c1-4-7-11(5-2)12-8-6-9-13(10-12)17(15,16)14-3/h6,8-11,14H,4-5,7H2,1-3H3 |
| InChIKey | LELFFCWFOJKDLB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |