C8H16FN — CID 139323857
(E,2S)-N-ethyl-3-fluorohex-3-en-2-amine (PubChem CID 139323857) has the molecular formula C8H16FN and a molecular weight of 145.22 g/mol. Its IUPAC name is (E,2S)-N-ethyl-3-fluorohex-3-en-2-amine.
| Compound Name | (E,2S)-N-ethyl-3-fluorohex-3-en-2-amine |
|---|---|
| PubChem CID | 139323857 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | (E,2S)-N-ethyl-3-fluorohex-3-en-2-amine |
| SMILES | CC/C=C(/F)[C@H](C)NCC |
| InChI | InChI=1S/C8H16FN/c1-4-6-8(9)7(3)10-5-2/h6-7,10H,4-5H2,1-3H3/b8-6+/t7-/m0/s1 |
| InChIKey | SZOYYORDGBPUST-DGUDBNDOSA-N |
| XLogP | 2.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |