C15H29N5O — CID 139324562
(Z,2Z)-4-amino-N-(1-aminoethyl)-2-[amino-(3-ethylpiperidin-1-yl)methylidene]pent-3-enamide (PubChem CID 139324562) has the molecular formula C15H29N5O and a molecular weight of 295.43 g/mol. Its IUPAC name is (Z,2Z)-4-amino-N-(1-aminoethyl)-2-[amino-(3-ethylpiperidin-1-yl)methylidene]pent-3-enamide.
| Compound Name | (Z,2Z)-4-amino-N-(1-aminoethyl)-2-[amino-(3-ethylpiperidin-1-yl)methylidene]pent-3-enamide |
|---|---|
| PubChem CID | 139324562 |
| Molecular Formula | C15H29N5O |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | (Z,2Z)-4-amino-N-(1-aminoethyl)-2-[amino-(3-ethylpiperidin-1-yl)methylidene]pent-3-enamide |
| SMILES | CCC1CCCN(/C(N)=C(/C=C(/C)N)C(=O)NC(C)N)C1 |
| InChI | InChI=1S/C15H29N5O/c1-4-12-6-5-7-20(9-12)14(18)13(8-10(2)16)15(21)19-11(3)17/h8,11-12H,4-7,9,16-18H2,1-3H3,(H,19,21)/b10-8-,14-13- |
| InChIKey | NNUCKADSWNMWDD-URCZFJKLSA-N |
| XLogP | 0.56 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|