C14H26N6O — CID 139324411
(Z,2Z)-4-amino-2-[amino-(3-aminopyrrolidin-1-yl)methylidene]-N-[amino(cyclopropyl)methyl]pent-3-enamide (PubChem CID 139324411) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is (Z,2Z)-4-amino-2-[amino-(3-aminopyrrolidin-1-yl)methylidene]-N-[amino(cyclopropyl)methyl]pent-3-enamide.
| Compound Name | (Z,2Z)-4-amino-2-[amino-(3-aminopyrrolidin-1-yl)methylidene]-N-[amino(cyclopropyl)methyl]pent-3-enamide |
|---|---|
| PubChem CID | 139324411 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (Z,2Z)-4-amino-2-[amino-(3-aminopyrrolidin-1-yl)methylidene]-N-[amino(cyclopropyl)methyl]pent-3-enamide |
| SMILES | C/C(N)=C/C(C(=O)NC(N)C1CC1)=C(\N)N1CCC(N)C1 |
| InChI | InChI=1S/C14H26N6O/c1-8(15)6-11(13(18)20-5-4-10(16)7-20)14(21)19-12(17)9-2-3-9/h6,9-10,12H,2-5,7,15-18H2,1H3,(H,19,21)/b8-6-,13-11- |
| InChIKey | RRNFVAFVJXLKQU-MJQGXCIASA-N |
| XLogP | -1.14 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|