C28H30F2N2O2 — CID 139325043
[4-[2-[[3-fluoro-5-[(2-fluorophenyl)methyl]phenyl]methoxy]ethyl]piperazin-1-yl]-(4-methylphenyl)methanone (PubChem CID 139325043) has the molecular formula C28H30F2N2O2 and a molecular weight of 464.56 g/mol. Its IUPAC name is [4-[2-[[3-fluoro-5-[(2-fluorophenyl)methyl]phenyl]methoxy]ethyl]piperazin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-[2-[[3-fluoro-5-[(2-fluorophenyl)methyl]phenyl]methoxy]ethyl]piperazin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 139325043 |
| Molecular Formula | C28H30F2N2O2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [4-[2-[[3-fluoro-5-[(2-fluorophenyl)methyl]phenyl]methoxy]ethyl]piperazin-1-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(CCOCc3cc(F)cc(Cc4ccccc4F)c3)CC2)cc1 |
| InChI | InChI=1S/C28H30F2N2O2/c1-21-6-8-24(9-7-21)28(33)32-12-10-31(11-13-32)14-15-34-20-23-16-22(18-26(29)19-23)17-25-4-2-3-5-27(25)30/h2-9,16,18-19H,10-15,17,20H2,1H3 |
| InChIKey | QPGALOKLCRZABV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|