C17H15BrN6O4S2 — CID 139328145
5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile (PubChem CID 139328145) has the molecular formula C17H15BrN6O4S2 and a molecular weight of 511.38 g/mol. Its IUPAC name is 5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile.
| Compound Name | 5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 139328145 |
| Molecular Formula | C17H15BrN6O4S2 |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | 5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(1,3-thiazol-2-yl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(Br)cc1S[C@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3nccs3)nn2)[C@H]1O |
| InChI | InChI=1S/C17H15BrN6O4S2/c18-8-3-12(9(4-19)21-5-8)30-17-15(27)13(14(26)11(7-25)28-17)24-6-10(22-23-24)16-20-1-2-29-16/h1-3,5-6,11,13-15,17,25-27H,7H2/t11-,13+,14+,15-,17-/m1/s1 |
| InChIKey | SDXGBTMSIQLSQF-YNIRGQLTSA-N |
| XLogP | 1.20 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |