C21H16BrF3N4O4S — CID 175229596
5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile (PubChem CID 175229596) has the molecular formula C21H16BrF3N4O4S and a molecular weight of 557.35 g/mol. Its IUPAC name is 5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile.
| Compound Name | 5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 175229596 |
| Molecular Formula | C21H16BrF3N4O4S |
| Molecular Weight | 557.35 g/mol |
| Exact Mass | 556.00 |
| IUPAC Name | 5-bromo-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(Br)cc1S[C@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)cn2)[C@H]1O |
| InChI | InChI=1S/C21H16BrF3N4O4S/c22-11-3-16(14(4-26)27-6-11)34-21-20(32)18(19(31)15(8-30)33-21)29-7-10(5-28-29)9-1-12(23)17(25)13(24)2-9/h1-3,5-7,15,18-21,30-32H,8H2/t15-,18+,19+,20-,21-/m1/s1 |
| InChIKey | GQZIRUZNYDTNKJ-YNUHATHGSA-N |
| XLogP | 2.77 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|