C18H15Cl2N5O4S2 — CID 175229560
5-chloro-3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-2-carbonitrile (PubChem CID 175229560) has the molecular formula C18H15Cl2N5O4S2 and a molecular weight of 500.39 g/mol. Its IUPAC name is 5-chloro-3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-2-carbonitrile.
| Compound Name | 5-chloro-3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 175229560 |
| Molecular Formula | C18H15Cl2N5O4S2 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 498.99 |
| IUPAC Name | 5-chloro-3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpyridine-2-carbonitrile |
| SMILES | N#Cc1ncc(Cl)cc1S[C@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3nc(Cl)cs3)cn2)[C@H]1O |
| InChI | InChI=1S/C18H15Cl2N5O4S2/c19-9-1-12(10(2-21)22-4-9)31-18-16(28)14(15(27)11(6-26)29-18)25-5-8(3-23-25)17-24-13(20)7-30-17/h1,3-5,7,11,14-16,18,26-28H,6H2/t11-,14+,15+,16-,18-/m1/s1 |
| InChIKey | YHLRNCYDGGMOIS-PTERYMMESA-N |
| XLogP | 2.35 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |