C23H20F3N3O4S — CID 164941030
(3R,4S,6R)-6-[(5-ethynyl-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-3-ol (PubChem CID 164941030) has the molecular formula C23H20F3N3O4S and a molecular weight of 491.49 g/mol. Its IUPAC name is (3R,4S,6R)-6-[(5-ethynyl-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-3-ol.
| Compound Name | (3R,4S,6R)-6-[(5-ethynyl-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 164941030 |
| Molecular Formula | C23H20F3N3O4S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | (3R,4S,6R)-6-[(5-ethynyl-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-methoxy-4-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]oxan-3-ol |
| SMILES | C#Cc1cncc(S[C@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)cn3)C2OC)c1 |
| InChI | InChI=1S/C23H20F3N3O4S/c1-3-12-4-15(9-27-7-12)34-23-22(32-2)20(21(31)18(11-30)33-23)29-10-14(8-28-29)13-5-16(24)19(26)17(25)6-13/h1,4-10,18,20-23,30-31H,11H2,2H3/t18?,20-,21-,22?,23+/m0/s1 |
| InChIKey | XSEBUXDCVYCNIK-JTFFECAXSA-N |
| XLogP | 2.77 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|