C14H15ClF3NO3 — CID 139332201
2-(8-chloro-4-cyclopropyl-3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-3,3,3-trifluoropropane-1,2-diol (PubChem CID 139332201) has the molecular formula C14H15ClF3NO3 and a molecular weight of 337.73 g/mol. Its IUPAC name is 2-(8-chloro-4-cyclopropyl-3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-3,3,3-trifluoropropane-1,2-diol.
| Compound Name | 2-(8-chloro-4-cyclopropyl-3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-3,3,3-trifluoropropane-1,2-diol |
|---|---|
| PubChem CID | 139332201 |
| Molecular Formula | C14H15ClF3NO3 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(8-chloro-4-cyclopropyl-3,4-dihydro-2H-pyrano[2,3-c]pyridin-6-yl)-3,3,3-trifluoropropane-1,2-diol |
| SMILES | OCC(O)(c1cc2c(c(Cl)n1)OCCC2C1CC1)C(F)(F)F |
| InChI | InChI=1S/C14H15ClF3NO3/c15-12-11-9(8(3-4-22-11)7-1-2-7)5-10(19-12)13(21,6-20)14(16,17)18/h5,7-8,20-21H,1-4,6H2 |
| InChIKey | CMNKGKFEDLHRKR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|