C14H22N4 — CID 139332649
2-[3-(cyanomethyl)-5-cyclohexyl-1,3-diazinan-1-yl]acetonitrile (PubChem CID 139332649) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-[3-(cyanomethyl)-5-cyclohexyl-1,3-diazinan-1-yl]acetonitrile.
| Compound Name | 2-[3-(cyanomethyl)-5-cyclohexyl-1,3-diazinan-1-yl]acetonitrile |
|---|---|
| PubChem CID | 139332649 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-[3-(cyanomethyl)-5-cyclohexyl-1,3-diazinan-1-yl]acetonitrile |
| SMILES | N#CCN1CC(C2CCCCC2)CN(CC#N)C1 |
| InChI | InChI=1S/C14H22N4/c15-6-8-17-10-14(11-18(12-17)9-7-16)13-4-2-1-3-5-13/h13-14H,1-5,8-12H2 |
| InChIKey | GVFXHHBKFASHJK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|