C28H29N3 — CID 139334017
7-(1,8,11-trimethyl-11-propan-2-yl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)benzo[h]quinoline (PubChem CID 139334017) has the molecular formula C28H29N3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 7-(1,8,11-trimethyl-11-propan-2-yl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)benzo[h]quinoline.
| Compound Name | 7-(1,8,11-trimethyl-11-propan-2-yl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)benzo[h]quinoline |
|---|---|
| PubChem CID | 139334017 |
| Molecular Formula | C28H29N3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 7-(1,8,11-trimethyl-11-propan-2-yl-3,5-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl)benzo[h]quinoline |
| SMILES | CC(C)C1(C)C2(C)CCC1(C)c1nc(-c3cccc4c3ccc3cccnc34)ncc12 |
| InChI | InChI=1S/C28H29N3/c1-17(2)28(5)26(3)13-14-27(28,4)24-22(26)16-30-25(31-24)21-10-6-9-20-19(21)12-11-18-8-7-15-29-23(18)20/h6-12,15-17H,13-14H2,1-5H3 |
| InChIKey | YATFYNYLKLXAOF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|