C17H21FN2O5 — CID 139336961
ethyl (E)-4-(4-fluorophenyl)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate (PubChem CID 139336961) has the molecular formula C17H21FN2O5 and a molecular weight of 352.36 g/mol. Its IUPAC name is ethyl (E)-4-(4-fluorophenyl)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate.
| Compound Name | ethyl (E)-4-(4-fluorophenyl)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate |
|---|---|
| PubChem CID | 139336961 |
| Molecular Formula | C17H21FN2O5 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | ethyl (E)-4-(4-fluorophenyl)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyldiazenyl]but-2-enoate |
| SMILES | CCOC(=O)C(/N=N/C(=O)OC(C)(C)C)=C(\O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN2O5/c1-5-24-15(22)14(19-20-16(23)25-17(2,3)4)13(21)10-11-6-8-12(18)9-7-11/h6-9,21H,5,10H2,1-4H3/b14-13+,20-19+ |
| InChIKey | FIOXJOOZSCTRGE-CINXTQGDSA-N |
| XLogP | 4.09 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|