C18H19F5S — CID 139337735
dimethyl-(2,3,4,5,6-pentafluorophenyl)-(4-phenylbutan-2-yl)-λ4-sulfane (PubChem CID 139337735) has the molecular formula C18H19F5S and a molecular weight of 362.41 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentafluorophenyl)-(4-phenylbutan-2-yl)-λ4-sulfane.
| Compound Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-(4-phenylbutan-2-yl)-λ4-sulfane |
|---|---|
| PubChem CID | 139337735 |
| Molecular Formula | C18H19F5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentafluorophenyl)-(4-phenylbutan-2-yl)-λ4-sulfane |
| SMILES | CC(CCc1ccccc1)S(C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H19F5S/c1-11(9-10-12-7-5-4-6-8-12)24(2,3)18-16(22)14(20)13(19)15(21)17(18)23/h4-8,11H,9-10H2,1-3H3 |
| InChIKey | QKKPEHFWZYVASU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|