C11H11FN4O4 — CID 139348321
2-fluoro-4-[(2S)-2-hydroxy-3-(tetrazol-2-yl)propoxy]benzoic acid (PubChem CID 139348321) has the molecular formula C11H11FN4O4 and a molecular weight of 282.23 g/mol. Its IUPAC name is 2-fluoro-4-[(2S)-2-hydroxy-3-(tetrazol-2-yl)propoxy]benzoic acid.
| Compound Name | 2-fluoro-4-[(2S)-2-hydroxy-3-(tetrazol-2-yl)propoxy]benzoic acid |
|---|---|
| PubChem CID | 139348321 |
| Molecular Formula | C11H11FN4O4 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-fluoro-4-[(2S)-2-hydroxy-3-(tetrazol-2-yl)propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OC[C@@H](O)Cn2ncnn2)cc1F |
| InChI | InChI=1S/C11H11FN4O4/c12-10-3-8(1-2-9(10)11(18)19)20-5-7(17)4-16-14-6-13-15-16/h1-3,6-7,17H,4-5H2,(H,18,19)/t7-/m0/s1 |
| InChIKey | RNUAMVFAPLJACQ-ZETCQYMHSA-N |
| XLogP | -0.05 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |