C9H18F3NO3 — CID 139349054
1-amino-5-methylhexan-3-ol;2,2,2-trifluoroacetic acid (PubChem CID 139349054) has the molecular formula C9H18F3NO3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-amino-5-methylhexan-3-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 1-amino-5-methylhexan-3-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 139349054 |
| Molecular Formula | C9H18F3NO3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-amino-5-methylhexan-3-ol;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CC(O)CCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H17NO.C2HF3O2/c1-6(2)5-7(9)3-4-8;3-2(4,5)1(6)7/h6-7,9H,3-5,8H2,1-2H3;(H,6,7) |
| InChIKey | WDHZPENQHHRQGB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |