C15H30O3S — CID 139355349
[4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-2,4-dimethylpentan-2-yl] ethenyl carbonate (PubChem CID 139355349) has the molecular formula C15H30O3S and a molecular weight of 290.47 g/mol. Its IUPAC name is [4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-2,4-dimethylpentan-2-yl] ethenyl carbonate.
| Compound Name | [4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-2,4-dimethylpentan-2-yl] ethenyl carbonate |
|---|---|
| PubChem CID | 139355349 |
| Molecular Formula | C15H30O3S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [4-[dimethyl(propan-2-yl)-λ4-sulfanyl]-2,4-dimethylpentan-2-yl] ethenyl carbonate |
| SMILES | C=COC(=O)OC(C)(C)CC(C)(C)S(C)(C)C(C)C |
| InChI | InChI=1S/C15H30O3S/c1-10-17-13(16)18-14(4,5)11-15(6,7)19(8,9)12(2)3/h10,12H,1,11H2,2-9H3 |
| InChIKey | FSNTWQCTPMOMAV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|