C17H23NO3 — CID 139356742
3-[2-[5-(4-methylphenoxy)pentoxy]ethyl]-1,2-oxazole (PubChem CID 139356742) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-[2-[5-(4-methylphenoxy)pentoxy]ethyl]-1,2-oxazole.
| Compound Name | 3-[2-[5-(4-methylphenoxy)pentoxy]ethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 139356742 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-[2-[5-(4-methylphenoxy)pentoxy]ethyl]-1,2-oxazole |
| SMILES | Cc1ccc(OCCCCCOCCc2ccon2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-15-5-7-17(8-6-15)20-12-4-2-3-11-19-13-9-16-10-14-21-18-16/h5-8,10,14H,2-4,9,11-13H2,1H3 |
| InChIKey | AKHHLPUUMLDAQT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|