C17H25NO4 — CID 142409422
ethane;3-[2-[2-(2-phenoxyethoxy)ethoxy]ethyl]-1,2-oxazole (PubChem CID 142409422) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is ethane;3-[2-[2-(2-phenoxyethoxy)ethoxy]ethyl]-1,2-oxazole.
| Compound Name | ethane;3-[2-[2-(2-phenoxyethoxy)ethoxy]ethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142409422 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | ethane;3-[2-[2-(2-phenoxyethoxy)ethoxy]ethyl]-1,2-oxazole |
| SMILES | CC.c1ccc(OCCOCCOCCc2ccon2)cc1 |
| InChI | InChI=1S/C15H19NO4.C2H6/c1-2-4-15(5-3-1)19-13-12-18-11-10-17-8-6-14-7-9-20-16-14;1-2/h1-5,7,9H,6,8,10-13H2;1-2H3 |
| InChIKey | LBWLFCRVKXKEPC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|