C16H23NO3 — CID 153330525
ethane;3-[2-(3-phenoxypropoxy)ethyl]-1,2-oxazole (PubChem CID 153330525) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethane;3-[2-(3-phenoxypropoxy)ethyl]-1,2-oxazole.
| Compound Name | ethane;3-[2-(3-phenoxypropoxy)ethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 153330525 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethane;3-[2-(3-phenoxypropoxy)ethyl]-1,2-oxazole |
| SMILES | CC.c1ccc(OCCCOCCc2ccon2)cc1 |
| InChI | InChI=1S/C14H17NO3.C2H6/c1-2-5-14(6-3-1)17-10-4-9-16-11-7-13-8-12-18-15-13;1-2/h1-3,5-6,8,12H,4,7,9-11H2;1-2H3 |
| InChIKey | SFEACEHBRJECPU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|