C12H21N3O2 — CID 142385868
3-[2-(3-piperazin-1-ylpropoxy)ethyl]-1,2-oxazole (PubChem CID 142385868) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-[2-(3-piperazin-1-ylpropoxy)ethyl]-1,2-oxazole.
| Compound Name | 3-[2-(3-piperazin-1-ylpropoxy)ethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142385868 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 3-[2-(3-piperazin-1-ylpropoxy)ethyl]-1,2-oxazole |
| SMILES | c1cc(CCOCCCN2CCNCC2)no1 |
| InChI | InChI=1S/C12H21N3O2/c1(6-15-7-4-13-5-8-15)9-16-10-2-12-3-11-17-14-12/h3,11,13H,1-2,4-10H2 |
| InChIKey | HKWIMRPYRPZRKF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|