C16H31N3O — CID 142386109
ethane;3-[6-(4-methylpiperazin-1-yl)hexyl]-1,2-oxazole (PubChem CID 142386109) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is ethane;3-[6-(4-methylpiperazin-1-yl)hexyl]-1,2-oxazole.
| Compound Name | ethane;3-[6-(4-methylpiperazin-1-yl)hexyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142386109 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | ethane;3-[6-(4-methylpiperazin-1-yl)hexyl]-1,2-oxazole |
| SMILES | CC.CN1CCN(CCCCCCc2ccon2)CC1 |
| InChI | InChI=1S/C14H25N3O.C2H6/c1-16-9-11-17(12-10-16)8-5-3-2-4-6-14-7-13-18-15-14;1-2/h7,13H,2-6,8-12H2,1H3;1-2H3 |
| InChIKey | XMZDHHREATWKCC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|