C17H23N3O2 — CID 142385764
3-[2-[2-(4-phenylpiperazin-1-yl)ethoxy]ethyl]-1,2-oxazole (PubChem CID 142385764) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-[2-[2-(4-phenylpiperazin-1-yl)ethoxy]ethyl]-1,2-oxazole.
| Compound Name | 3-[2-[2-(4-phenylpiperazin-1-yl)ethoxy]ethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142385764 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 3-[2-[2-(4-phenylpiperazin-1-yl)ethoxy]ethyl]-1,2-oxazole |
| SMILES | c1ccc(N2CCN(CCOCCc3ccon3)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-4-17(5-3-1)20-10-8-19(9-11-20)12-15-21-13-6-16-7-14-22-18-16/h1-5,7,14H,6,8-13,15H2 |
| InChIKey | PHRCTXRCLVCQBF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|