C15H29N3O2 — CID 142390718
ethane;3-[4-(4-methylpiperazin-1-yl)butoxymethyl]-1,2-oxazole (PubChem CID 142390718) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is ethane;3-[4-(4-methylpiperazin-1-yl)butoxymethyl]-1,2-oxazole.
| Compound Name | ethane;3-[4-(4-methylpiperazin-1-yl)butoxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 142390718 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | ethane;3-[4-(4-methylpiperazin-1-yl)butoxymethyl]-1,2-oxazole |
| SMILES | CC.CN1CCN(CCCCOCc2ccon2)CC1 |
| InChI | InChI=1S/C13H23N3O2.C2H6/c1-15-6-8-16(9-7-15)5-2-3-10-17-12-13-4-11-18-14-13;1-2/h4,11H,2-3,5-10,12H2,1H3;1-2H3 |
| InChIKey | IFDBAOLCIYYQBC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|