C10H18N4O3S — CID 81176676
N-(1,2-oxazol-3-ylmethyl)-2-piperazin-1-ylethanesulfonamide (PubChem CID 81176676) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-2-piperazin-1-ylethanesulfonamide.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-2-piperazin-1-ylethanesulfonamide |
|---|---|
| PubChem CID | 81176676 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-2-piperazin-1-ylethanesulfonamide |
| SMILES | O=S(=O)(CCN1CCNCC1)NCc1ccon1 |
| InChI | InChI=1S/C10H18N4O3S/c15-18(16,12-9-10-1-7-17-13-10)8-6-14-4-2-11-3-5-14/h1,7,11-12H,2-6,8-9H2 |
| InChIKey | WSKPGYKREZKYMQ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |