C13H19F2N3O2S — CID 63790846
N-[(2,5-difluorophenyl)methyl]-2-piperazin-1-ylethanesulfonamide (PubChem CID 63790846) has the molecular formula C13H19F2N3O2S and a molecular weight of 319.38 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-2-piperazin-1-ylethanesulfonamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-2-piperazin-1-ylethanesulfonamide |
|---|---|
| PubChem CID | 63790846 |
| Molecular Formula | C13H19F2N3O2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-2-piperazin-1-ylethanesulfonamide |
| SMILES | O=S(=O)(CCN1CCNCC1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2N3O2S/c14-12-1-2-13(15)11(9-12)10-17-21(19,20)8-7-18-5-3-16-4-6-18/h1-2,9,16-17H,3-8,10H2 |
| InChIKey | ORAFGLRYACSHOF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |