About 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine
1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine (PubChem CID 82305165) has the molecular formula C15H22F2N2
and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine.
Molecular Properties
| Compound Name | 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine |
| PubChem CID | 82305165 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine |
| SMILES | CC(C)(Cc1cc(F)ccc1F)CN1CCNCC1 |
| InChI | InChI=1S/C15H22F2N2/c1-15(2,11-19-7-5-18-6-8-19)10-12-9-13(16)3-4-14(12)17/h3-4,9,18H,5-8,10-11H2,1-2H3 |
| InChIKey | FRHWYWHCNDMXJL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine?
The IUPAC name of 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine (CID 82305165) is 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine.
What is the SMILES notation for 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine?
The canonical SMILES for 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine is CC(C)(Cc1cc(F)ccc1F)CN1CCNCC1.
What is the InChIKey of 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine?
The InChIKey is FRHWYWHCNDMXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F2N2/c1-15(2,11-19-7-5-18-6-8-19)10-12-9-13(16)3-4-14(12)17/h3-4,9,18H,5-8,10-11H2,1-2H3.
What are the key properties of 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine?
1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine has a molecular weight of 268.35 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,5-difluorophenyl)-2,2-dimethylpropyl]piperazine is sourced from PubChem (CID 82305165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).