C33H65N — CID 139362635
2,2,4,4,7,9,9,11,13,16,16,18,18-tridecamethyl-5-propan-2-yl-5-azabicyclo[8.8.0]octadecane (PubChem CID 139362635) has the molecular formula C33H65N and a molecular weight of 475.89 g/mol. Its IUPAC name is 2,2,4,4,7,9,9,11,13,16,16,18,18-tridecamethyl-5-propan-2-yl-5-azabicyclo[8.8.0]octadecane.
| Compound Name | 2,2,4,4,7,9,9,11,13,16,16,18,18-tridecamethyl-5-propan-2-yl-5-azabicyclo[8.8.0]octadecane |
|---|---|
| PubChem CID | 139362635 |
| Molecular Formula | C33H65N |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 475.51 |
| IUPAC Name | 2,2,4,4,7,9,9,11,13,16,16,18,18-tridecamethyl-5-propan-2-yl-5-azabicyclo[8.8.0]octadecane |
| SMILES | CC1CCC(C)(C)CC(C)(C)C2C(C(C)C1)C(C)(C)CC(C)CN(C(C)C)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C33H65N/c1-23(2)34-20-25(4)19-30(8,9)27-26(5)18-24(3)16-17-29(6,7)21-31(10,11)28(27)32(12,13)22-33(34,14)15/h23-28H,16-22H2,1-15H3 |
| InChIKey | FWSKPOLLEBKVAK-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |