C23H47N — CID 142476230
2,2,4,4,7,7,9,9-octamethyl-1,6-di(propan-2-yl)azecane (PubChem CID 142476230) has the molecular formula C23H47N and a molecular weight of 337.64 g/mol. Its IUPAC name is 2,2,4,4,7,7,9,9-octamethyl-1,6-di(propan-2-yl)azecane.
| Compound Name | 2,2,4,4,7,7,9,9-octamethyl-1,6-di(propan-2-yl)azecane |
|---|---|
| PubChem CID | 142476230 |
| Molecular Formula | C23H47N |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 337.37 |
| IUPAC Name | 2,2,4,4,7,7,9,9-octamethyl-1,6-di(propan-2-yl)azecane |
| SMILES | CC(C)C1CC(C)(C)CC(C)(C)N(C(C)C)CC(C)(C)CC1(C)C |
| InChI | InChI=1S/C23H47N/c1-17(2)19-13-20(5,6)15-23(11,12)24(18(3)4)16-21(7,8)14-22(19,9)10/h17-19H,13-16H2,1-12H3 |
| InChIKey | PVCDVSRBCYBMJI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |