C12H24 — CID 164756957
(3S)-1,1,2,3,5,5-hexamethylcyclohexane (PubChem CID 164756957) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is (3S)-1,1,2,3,5,5-hexamethylcyclohexane.
| Compound Name | (3S)-1,1,2,3,5,5-hexamethylcyclohexane |
|---|---|
| PubChem CID | 164756957 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | (3S)-1,1,2,3,5,5-hexamethylcyclohexane |
| SMILES | CC1[C@@H](C)CC(C)(C)CC1(C)C |
| InChI | InChI=1S/C12H24/c1-9-7-11(3,4)8-12(5,6)10(9)2/h9-10H,7-8H2,1-6H3/t9-,10?/m0/s1 |
| InChIKey | DEXPDXUUJBNIRM-RGURZIINSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |