C17H21N5O4S — CID 139368292
N-hydroxy-2-[4-[4-(1-methylimidazol-2-yl)sulfonylpiperazin-1-yl]phenyl]prop-2-enamide (PubChem CID 139368292) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-hydroxy-2-[4-[4-(1-methylimidazol-2-yl)sulfonylpiperazin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-2-[4-[4-(1-methylimidazol-2-yl)sulfonylpiperazin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139368292 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-hydroxy-2-[4-[4-(1-methylimidazol-2-yl)sulfonylpiperazin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=C(C(=O)NO)c1ccc(N2CCN(S(=O)(=O)c3nccn3C)CC2)cc1 |
| InChI | InChI=1S/C17H21N5O4S/c1-13(16(23)19-24)14-3-5-15(6-4-14)21-9-11-22(12-10-21)27(25,26)17-18-7-8-20(17)2/h3-8,24H,1,9-12H2,2H3,(H,19,23) |
| InChIKey | WIBCUOYTOGMRCQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|