C23H28N4O5 — CID 139368315
[7-(2-aminoanilino)-1-(3-cyclopropyloxyanilino)-1,7-dioxoheptan-2-yl]carbamic acid (PubChem CID 139368315) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is [7-(2-aminoanilino)-1-(3-cyclopropyloxyanilino)-1,7-dioxoheptan-2-yl]carbamic acid.
| Compound Name | [7-(2-aminoanilino)-1-(3-cyclopropyloxyanilino)-1,7-dioxoheptan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 139368315 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [7-(2-aminoanilino)-1-(3-cyclopropyloxyanilino)-1,7-dioxoheptan-2-yl]carbamic acid |
| SMILES | Nc1ccccc1NC(=O)CCCCC(NC(=O)O)C(=O)Nc1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C23H28N4O5/c24-18-8-1-2-9-19(18)26-21(28)11-4-3-10-20(27-23(30)31)22(29)25-15-6-5-7-17(14-15)32-16-12-13-16/h1-2,5-9,14,16,20,27H,3-4,10-13,24H2,(H,25,29)(H,26,28)(H,30,31) |
| InChIKey | NRXSOGUQTGUKEM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|