C25H22F8N4O2S — CID 139368393
(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-[(3-methyltriazol-4-yl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole (PubChem CID 139368393) has the molecular formula C25H22F8N4O2S and a molecular weight of 594.53 g/mol. Its IUPAC name is (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-[(3-methyltriazol-4-yl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole.
| Compound Name | (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-[(3-methyltriazol-4-yl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
|---|---|
| PubChem CID | 139368393 |
| Molecular Formula | C25H22F8N4O2S |
| Molecular Weight | 594.53 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-[(3-methyltriazol-4-yl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
| SMILES | Cn1nncc1CN1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C25H22F8N4O2S/c1-36-18(13-34-35-36)14-37-11-10-22(40(38,39)19-6-4-17(26)5-7-19)20-8-3-16(12-15(20)2-9-21(22)37)23(27,24(28,29)30)25(31,32)33/h3-8,12-13,21H,2,9-11,14H2,1H3/t21-,22-/m1/s1 |
| InChIKey | MYOQXJXZHGJOAY-FGZHOGPDSA-N |
| XLogP | 5.13 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |