C23H29F3N2O — CID 139369069
2-[[4-(dibenzylamino)cyclohexyl]amino]-3,3,3-trifluoropropan-1-ol (PubChem CID 139369069) has the molecular formula C23H29F3N2O and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[[4-(dibenzylamino)cyclohexyl]amino]-3,3,3-trifluoropropan-1-ol.
| Compound Name | 2-[[4-(dibenzylamino)cyclohexyl]amino]-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 139369069 |
| Molecular Formula | C23H29F3N2O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-[[4-(dibenzylamino)cyclohexyl]amino]-3,3,3-trifluoropropan-1-ol |
| SMILES | OCC(NC1CCC(N(Cc2ccccc2)Cc2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C23H29F3N2O/c24-23(25,26)22(17-29)27-20-11-13-21(14-12-20)28(15-18-7-3-1-4-8-18)16-19-9-5-2-6-10-19/h1-10,20-22,27,29H,11-17H2 |
| InChIKey | QXBOBNBOKANGGY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |