C22H33F2N5 — CID 153404785
4-[(2-aminohydrazinyl)methyl]-N,N-dibenzylcyclohexan-1-amine;difluoromethanamine (PubChem CID 153404785) has the molecular formula C22H33F2N5 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-[(2-aminohydrazinyl)methyl]-N,N-dibenzylcyclohexan-1-amine;difluoromethanamine.
| Compound Name | 4-[(2-aminohydrazinyl)methyl]-N,N-dibenzylcyclohexan-1-amine;difluoromethanamine |
|---|---|
| PubChem CID | 153404785 |
| Molecular Formula | C22H33F2N5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 4-[(2-aminohydrazinyl)methyl]-N,N-dibenzylcyclohexan-1-amine;difluoromethanamine |
| SMILES | NC(F)F.NNNCC1CCC(N(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4.CH3F2N/c22-24-23-15-18-11-13-21(14-12-18)25(16-19-7-3-1-4-8-19)17-20-9-5-2-6-10-20;2-1(3)4/h1-10,18,21,23-24H,11-17,22H2;1H,4H2 |
| InChIKey | RIQUJQYPCMKEDJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|