C8H11N3OS — CID 139371051
2-(thietan-3-ylmethyl)pyrazole-3-carboxamide (PubChem CID 139371051) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-(thietan-3-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 2-(thietan-3-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 139371051 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-(thietan-3-ylmethyl)pyrazole-3-carboxamide |
| SMILES | NC(=O)c1ccnn1CC1CSC1 |
| InChI | InChI=1S/C8H11N3OS/c9-8(12)7-1-2-10-11(7)3-6-4-13-5-6/h1-2,6H,3-5H2,(H2,9,12) |
| InChIKey | JAHOHFFNTYTXEB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |