C14H14ClF2N3O — CID 139371482
5-chloro-6,7-difluoro-N-[[(3R)-pyrrolidin-3-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 139371482) has the molecular formula C14H14ClF2N3O and a molecular weight of 313.74 g/mol. Its IUPAC name is 5-chloro-6,7-difluoro-N-[[(3R)-pyrrolidin-3-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-6,7-difluoro-N-[[(3R)-pyrrolidin-3-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 139371482 |
| Molecular Formula | C14H14ClF2N3O |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 5-chloro-6,7-difluoro-N-[[(3R)-pyrrolidin-3-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCNC1)c1cc2cc(Cl)c(F)c(F)c2[nH]1 |
| InChI | InChI=1S/C14H14ClF2N3O/c15-9-3-8-4-10(20-13(8)12(17)11(9)16)14(21)19-6-7-1-2-18-5-7/h3-4,7,18,20H,1-2,5-6H2,(H,19,21)/t7-/m1/s1 |
| InChIKey | DCWAKQVZLADEPP-SSDOTTSWSA-N |
| XLogP | 2.44 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|