C13H12ClF2N3O — CID 139371650
5-chloro-6,7-difluoro-N-[(2R,3R)-2-methylazetidin-3-yl]-1H-indole-2-carboxamide (PubChem CID 139371650) has the molecular formula C13H12ClF2N3O and a molecular weight of 299.71 g/mol. Its IUPAC name is 5-chloro-6,7-difluoro-N-[(2R,3R)-2-methylazetidin-3-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-6,7-difluoro-N-[(2R,3R)-2-methylazetidin-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 139371650 |
| Molecular Formula | C13H12ClF2N3O |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-chloro-6,7-difluoro-N-[(2R,3R)-2-methylazetidin-3-yl]-1H-indole-2-carboxamide |
| SMILES | C[C@H]1NC[C@H]1NC(=O)c1cc2cc(Cl)c(F)c(F)c2[nH]1 |
| InChI | InChI=1S/C13H12ClF2N3O/c1-5-9(4-17-5)19-13(20)8-3-6-2-7(14)10(15)11(16)12(6)18-8/h2-3,5,9,17-18H,4H2,1H3,(H,19,20)/t5-,9-/m1/s1 |
| InChIKey | CHLMBJNMGNWQDA-MLUIRONXSA-N |
| XLogP | 2.19 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|