C13H13ClF2N4O — CID 139371670
(5-chloro-6,7-difluoro-1H-indol-2-yl)-[(3S,4S)-3,4-diaminopyrrolidin-1-yl]methanone (PubChem CID 139371670) has the molecular formula C13H13ClF2N4O and a molecular weight of 314.72 g/mol. Its IUPAC name is (5-chloro-6,7-difluoro-1H-indol-2-yl)-[(3S,4S)-3,4-diaminopyrrolidin-1-yl]methanone.
| Compound Name | (5-chloro-6,7-difluoro-1H-indol-2-yl)-[(3S,4S)-3,4-diaminopyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 139371670 |
| Molecular Formula | C13H13ClF2N4O |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (5-chloro-6,7-difluoro-1H-indol-2-yl)-[(3S,4S)-3,4-diaminopyrrolidin-1-yl]methanone |
| SMILES | N[C@H]1CN(C(=O)c2cc3cc(Cl)c(F)c(F)c3[nH]2)C[C@@H]1N |
| InChI | InChI=1S/C13H13ClF2N4O/c14-6-1-5-2-9(19-12(5)11(16)10(6)15)13(21)20-3-7(17)8(18)4-20/h1-2,7-8,19H,3-4,17-18H2/t7-,8-/m0/s1 |
| InChIKey | STOGVUJSZYDCER-YUMQZZPRSA-N |
| XLogP | 1.21 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|