C40H78N4O3 — CID 139372831
N-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]octan-1-amine (PubChem CID 139372831) has the molecular formula C40H78N4O3 and a molecular weight of 663.09 g/mol. Its IUPAC name is N-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]octan-1-amine.
| Compound Name | N-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]octan-1-amine |
|---|---|
| PubChem CID | 139372831 |
| Molecular Formula | C40H78N4O3 |
| Molecular Weight | 663.09 g/mol |
| Exact Mass | 662.61 |
| IUPAC Name | N-[4-[(3R,7R,9S,10S,12S,13R,14S)-3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]octan-1-amine |
| SMILES | CCCCCCCCNCCCCC1CC[C@H]2C3C(OCCCN)CC4C[C@H](OCCCN)CC[C@]4(C)[C@H]3C[C@H](OCCCN)[C@]12C |
| InChI | InChI=1S/C40H78N4O3/c1-4-5-6-7-8-10-23-44-24-11-9-15-31-16-17-34-38-35(30-37(40(31,34)3)47-27-14-22-43)39(2)19-18-33(45-25-12-20-41)28-32(39)29-36(38)46-26-13-21-42/h31-38,44H,4-30,41-43H2,1-3H3/t31?,32?,33-,34+,35+,36?,37+,38?,39+,40-/m1/s1 |
| InChIKey | JAUPXVQIZFQTQA-VPIBERALSA-N |
| XLogP | 7.19 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.09 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|