C31H58N2O — CID 143658958
N-[4-[(10S,12S,13R)-12-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]pentan-1-amine (PubChem CID 143658958) has the molecular formula C31H58N2O and a molecular weight of 474.82 g/mol. Its IUPAC name is N-[4-[(10S,12S,13R)-12-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]pentan-1-amine.
| Compound Name | N-[4-[(10S,12S,13R)-12-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]pentan-1-amine |
|---|---|
| PubChem CID | 143658958 |
| Molecular Formula | C31H58N2O |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.45 |
| IUPAC Name | N-[4-[(10S,12S,13R)-12-(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]pentan-1-amine |
| SMILES | CCCCCNCCCCC1CCC2C3CCC4CCCC[C@]4(C)C3C[C@H](OCCCN)[C@]12C |
| InChI | InChI=1S/C31H58N2O/c1-4-5-9-20-33-21-10-7-13-25-15-17-27-26-16-14-24-12-6-8-18-30(24,2)28(26)23-29(31(25,27)3)34-22-11-19-32/h24-29,33H,4-23,32H2,1-3H3/t24?,25?,26?,27?,28?,29-,30-,31+/m0/s1 |
| InChIKey | PZNWKDSFBBLVDC-YUHWSCCYSA-N |
| XLogP | 7.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|