C39H76N3O3+ — CID 145190589
[(1S,12S,17S)-17-(3-aminopropoxy)-15-[(2R)-5-hydroxy-5-(octylamino)pentan-2-yl]-2,16-dimethyl-9-tetracyclo[9.7.0.02,7.012,16]octadecanyl]-(3-aminopropyl)oxidanium (PubChem CID 145190589) has the molecular formula C39H76N3O3+ and a molecular weight of 635.06 g/mol. Its IUPAC name is [(1S,12S,17S)-17-(3-aminopropoxy)-15-[(2R)-5-hydroxy-5-(octylamino)pentan-2-yl]-2,16-dimethyl-9-tetracyclo[9.7.0.02,7.012,16]octadecanyl]-(3-aminopropyl)oxidanium.
| Compound Name | [(1S,12S,17S)-17-(3-aminopropoxy)-15-[(2R)-5-hydroxy-5-(octylamino)pentan-2-yl]-2,16-dimethyl-9-tetracyclo[9.7.0.02,7.012,16]octadecanyl]-(3-aminopropyl)oxidanium |
|---|---|
| PubChem CID | 145190589 |
| Molecular Formula | C39H76N3O3+ |
| Molecular Weight | 635.06 g/mol |
| Exact Mass | 634.59 |
| IUPAC Name | [(1S,12S,17S)-17-(3-aminopropoxy)-15-[(2R)-5-hydroxy-5-(octylamino)pentan-2-yl]-2,16-dimethyl-9-tetracyclo[9.7.0.02,7.012,16]octadecanyl]-(3-aminopropyl)oxidanium |
| SMILES | CCCCCCCCNC(O)CC[C@@H](C)C1CC[C@H]2C3CC([OH+]CCCN)CC4CCCCC4(C)[C@H]3C[C@H](OCCCN)C12C |
| InChI | InChI=1S/C39H75N3O3/c1-5-6-7-8-9-12-23-42-37(43)19-16-29(2)33-17-18-34-32-27-31(44-24-13-21-40)26-30-15-10-11-20-38(30,3)35(32)28-36(39(33,34)4)45-25-14-22-41/h29-37,42-43H,5-28,40-41H2,1-4H3/p+1/t29-,30?,31?,32?,33?,34+,35+,36+,37?,38?,39?/m1/s1 |
| InChIKey | OLSYNXGWMKZRNY-ZUAKVSKWSA-O |
| XLogP | 7.31 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.06 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|