C28H53N3O4 — CID 22948682
3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 22948682) has the molecular formula C28H53N3O4 and a molecular weight of 495.75 g/mol. Its IUPAC name is 3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | 3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 22948682 |
| Molecular Formula | C28H53N3O4 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.40 |
| IUPAC Name | 3,7,12-tris(3-aminopropoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | CC12CCC(OCCCN)CC1CC(OCCCN)C1C2CC(OCCCN)C2(C)C(O)CCC12 |
| InChI | InChI=1S/C28H53N3O4/c1-27-9-8-20(33-13-3-10-29)16-19(27)17-23(34-14-4-11-30)26-21-6-7-24(32)28(21,2)25(18-22(26)27)35-15-5-12-31/h19-26,32H,3-18,29-31H2,1-2H3 |
| InChIKey | AVNWZLQHCNTTKU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|