C7H12N2O4 — CID 139372861
3-tert-butyl-4-hydroxy-1,3,5-oxadiazinane-2,6-dione (PubChem CID 139372861) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 3-tert-butyl-4-hydroxy-1,3,5-oxadiazinane-2,6-dione.
| Compound Name | 3-tert-butyl-4-hydroxy-1,3,5-oxadiazinane-2,6-dione |
|---|---|
| PubChem CID | 139372861 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-tert-butyl-4-hydroxy-1,3,5-oxadiazinane-2,6-dione |
| SMILES | CC(C)(C)N1C(=O)OC(=O)NC1O |
| InChI | InChI=1S/C7H12N2O4/c1-7(2,3)9-4(10)8-5(11)13-6(9)12/h4,10H,1-3H3,(H,8,11) |
| InChIKey | NQYVPAQHORFLQU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|