C8H16N3O3+ — CID 163936005
(1-tert-butyl-5-methyl-4,6-dioxo-1,3,5-triazinan-2-yl)oxidanium (PubChem CID 163936005) has the molecular formula C8H16N3O3+ and a molecular weight of 202.23 g/mol. Its IUPAC name is (1-tert-butyl-5-methyl-4,6-dioxo-1,3,5-triazinan-2-yl)oxidanium.
| Compound Name | (1-tert-butyl-5-methyl-4,6-dioxo-1,3,5-triazinan-2-yl)oxidanium |
|---|---|
| PubChem CID | 163936005 |
| Molecular Formula | C8H16N3O3+ |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1-tert-butyl-5-methyl-4,6-dioxo-1,3,5-triazinan-2-yl)oxidanium |
| SMILES | CN1C(=O)NC([OH2+])N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C8H15N3O3/c1-8(2,3)11-6(13)9-5(12)10(4)7(11)14/h6,13H,1-4H3,(H,9,12)/p+1 |
| InChIKey | RMWBVRKMHNSKEG-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|