C15H29N3O3 — CID 164822473
1,3,5-tritert-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione (PubChem CID 164822473) has the molecular formula C15H29N3O3 and a molecular weight of 299.42 g/mol. Its IUPAC name is 1,3,5-tritert-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione.
| Compound Name | 1,3,5-tritert-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 164822473 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 1,3,5-tritert-butyl-6-hydroxy-1,3,5-triazinane-2,4-dione |
| SMILES | CC(C)(C)N1C(=O)N(C(C)(C)C)C(O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H29N3O3/c1-13(2,3)16-10(19)17(14(4,5)6)12(21)18(11(16)20)15(7,8)9/h10,19H,1-9H3 |
| InChIKey | POFRETSLKFIBBT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |